C20H20ClF3N2O4S — CID 143205521
N-[4-chloro-2-[(E)-C-ethyl-N-[[4-(1-methoxyethenyl)phenyl]methoxy]carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 143205521) has the molecular formula C20H20ClF3N2O4S and a molecular weight of 476.90 g/mol. Its IUPAC name is N-[4-chloro-2-[(E)-C-ethyl-N-[[4-(1-methoxyethenyl)phenyl]methoxy]carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-chloro-2-[(E)-C-ethyl-N-[[4-(1-methoxyethenyl)phenyl]methoxy]carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 143205521 |
| Molecular Formula | C20H20ClF3N2O4S |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N-[4-chloro-2-[(E)-C-ethyl-N-[[4-(1-methoxyethenyl)phenyl]methoxy]carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | C=C(OC)c1ccc(CO/N=C(\CC)c2cc(Cl)ccc2NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20ClF3N2O4S/c1-4-18(25-30-12-14-5-7-15(8-6-14)13(2)29-3)17-11-16(21)9-10-19(17)26-31(27,28)20(22,23)24/h5-11,26H,2,4,12H2,1,3H3/b25-18+ |
| InChIKey | XTQBKNCYXAGGHE-XIEYBQDHSA-N |
| XLogP | 5.55 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|