C17H22ClF3N2O3S — CID 91245439
N-[4-chloro-2-(N-cyclohexyloxy-C-propylcarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 91245439) has the molecular formula C17H22ClF3N2O3S and a molecular weight of 426.89 g/mol. Its IUPAC name is N-[4-chloro-2-(N-cyclohexyloxy-C-propylcarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-chloro-2-(N-cyclohexyloxy-C-propylcarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 91245439 |
| Molecular Formula | C17H22ClF3N2O3S |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[4-chloro-2-(N-cyclohexyloxy-C-propylcarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCCC(=NOC1CCCCC1)c1cc(Cl)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H22ClF3N2O3S/c1-2-6-15(22-26-13-7-4-3-5-8-13)14-11-12(18)9-10-16(14)23-27(24,25)17(19,20)21/h9-11,13,23H,2-8H2,1H3 |
| InChIKey | UDWCLQJGFYPKID-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|