C15H17ClF3NO — CID 88957441
(E)-1-[5-chloro-2-(trifluoromethyl)phenyl]-N-cyclohexyloxyethanimine (PubChem CID 88957441) has the molecular formula C15H17ClF3NO and a molecular weight of 319.75 g/mol. Its IUPAC name is (E)-1-[5-chloro-2-(trifluoromethyl)phenyl]-N-cyclohexyloxyethanimine.
| Compound Name | (E)-1-[5-chloro-2-(trifluoromethyl)phenyl]-N-cyclohexyloxyethanimine |
|---|---|
| PubChem CID | 88957441 |
| Molecular Formula | C15H17ClF3NO |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (E)-1-[5-chloro-2-(trifluoromethyl)phenyl]-N-cyclohexyloxyethanimine |
| SMILES | C/C(=N\OC1CCCCC1)c1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C15H17ClF3NO/c1-10(20-21-12-5-3-2-4-6-12)13-9-11(16)7-8-14(13)15(17,18)19/h7-9,12H,2-6H2,1H3/b20-10+ |
| InChIKey | UUAXXKUHFJDLLU-KEBDBYFISA-N |
| XLogP | 5.43 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|