C16H11Cl3F3NO — CID 123195417
1-[5-chloro-2-(trifluoromethyl)phenyl]-N-[(2,6-dichlorophenyl)methoxy]ethanimine (PubChem CID 123195417) has the molecular formula C16H11Cl3F3NO and a molecular weight of 396.62 g/mol. Its IUPAC name is 1-[5-chloro-2-(trifluoromethyl)phenyl]-N-[(2,6-dichlorophenyl)methoxy]ethanimine.
| Compound Name | 1-[5-chloro-2-(trifluoromethyl)phenyl]-N-[(2,6-dichlorophenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 123195417 |
| Molecular Formula | C16H11Cl3F3NO |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 1-[5-chloro-2-(trifluoromethyl)phenyl]-N-[(2,6-dichlorophenyl)methoxy]ethanimine |
| SMILES | CC(=NOCc1c(Cl)cccc1Cl)c1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H11Cl3F3NO/c1-9(11-7-10(17)5-6-13(11)16(20,21)22)23-24-8-12-14(18)3-2-4-15(12)19/h2-7H,8H2,1H3 |
| InChIKey | GCLPKUIYLAYULT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|