C16H21F3N2O3S — CID 143205636
N-[2-[(E)-C-ethyl-N-(3-methylbut-2-enoxy)carbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 143205636) has the molecular formula C16H21F3N2O3S and a molecular weight of 378.42 g/mol. Its IUPAC name is N-[2-[(E)-C-ethyl-N-(3-methylbut-2-enoxy)carbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[(E)-C-ethyl-N-(3-methylbut-2-enoxy)carbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 143205636 |
| Molecular Formula | C16H21F3N2O3S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[2-[(E)-C-ethyl-N-(3-methylbut-2-enoxy)carbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC/C(=N\OCC=C(C)C)c1cc(C)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O3S/c1-5-14(20-24-9-8-11(2)3)13-10-12(4)6-7-15(13)21-25(22,23)16(17,18)19/h6-8,10,21H,5,9H2,1-4H3/b20-14+ |
| InChIKey | JSLQLSREROWGAW-XSFVSMFZSA-N |
| XLogP | 4.35 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|