C16H22F3N3O4S — CID 143554361
ethyl N-ethyl-N-[(E)-1-[5-methyl-2-(trifluoromethylsulfonylamino)phenyl]propylideneamino]carbamate (PubChem CID 143554361) has the molecular formula C16H22F3N3O4S and a molecular weight of 409.43 g/mol. Its IUPAC name is ethyl N-ethyl-N-[(E)-1-[5-methyl-2-(trifluoromethylsulfonylamino)phenyl]propylideneamino]carbamate.
| Compound Name | ethyl N-ethyl-N-[(E)-1-[5-methyl-2-(trifluoromethylsulfonylamino)phenyl]propylideneamino]carbamate |
|---|---|
| PubChem CID | 143554361 |
| Molecular Formula | C16H22F3N3O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | ethyl N-ethyl-N-[(E)-1-[5-methyl-2-(trifluoromethylsulfonylamino)phenyl]propylideneamino]carbamate |
| SMILES | CCOC(=O)N(CC)/N=C(\CC)c1cc(C)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H22F3N3O4S/c1-5-13(20-22(6-2)15(23)26-7-3)12-10-11(4)8-9-14(12)21-27(24,25)16(17,18)19/h8-10,21H,5-7H2,1-4H3/b20-13+ |
| InChIKey | HJWLJYRHTVEOSX-DEDYPNTBSA-N |
| XLogP | 3.85 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|