C19H20Cl2F3N3O2S — CID 143554349
N-[2-[(E)-N-(2,5-dichloro-N-propylanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 143554349) has the molecular formula C19H20Cl2F3N3O2S and a molecular weight of 482.36 g/mol. Its IUPAC name is N-[2-[(E)-N-(2,5-dichloro-N-propylanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[(E)-N-(2,5-dichloro-N-propylanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 143554349 |
| Molecular Formula | C19H20Cl2F3N3O2S |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | N-[2-[(E)-N-(2,5-dichloro-N-propylanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCCN(/N=C(\C)c1cc(C)ccc1NS(=O)(=O)C(F)(F)F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H20Cl2F3N3O2S/c1-4-9-27(18-11-14(20)6-7-16(18)21)25-13(3)15-10-12(2)5-8-17(15)26-30(28,29)19(22,23)24/h5-8,10-11,26H,4,9H2,1-3H3/b25-13+ |
| InChIKey | GRSKTHJHAHGLAA-DHRITJCHSA-N |
| XLogP | 6.20 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|