C20H24Cl2F3N3O2S — CID 143554323
N-[2-[(E)-N-(2,5-dichloro-N-ethylanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide;ethane (PubChem CID 143554323) has the molecular formula C20H24Cl2F3N3O2S and a molecular weight of 498.40 g/mol. Its IUPAC name is N-[2-[(E)-N-(2,5-dichloro-N-ethylanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide;ethane.
| Compound Name | N-[2-[(E)-N-(2,5-dichloro-N-ethylanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide;ethane |
|---|---|
| PubChem CID | 143554323 |
| Molecular Formula | C20H24Cl2F3N3O2S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N-[2-[(E)-N-(2,5-dichloro-N-ethylanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide;ethane |
| SMILES | CC.CCN(/N=C(\C)c1cc(C)ccc1NS(=O)(=O)C(F)(F)F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H18Cl2F3N3O2S.C2H6/c1-4-26(17-10-13(19)6-7-15(17)20)24-12(3)14-9-11(2)5-8-16(14)25-29(27,28)18(21,22)23;1-2/h5-10,25H,4H2,1-3H3;1-2H3/b24-12+; |
| InChIKey | SXWLZSYOCKZHGC-DFVQGABXSA-N |
| XLogP | 6.84 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|