C19H21F4N3O2S — CID 143554330
N-[2-[(E)-N-(N-ethyl-2-fluoroanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide (PubChem CID 143554330) has the molecular formula C19H21F4N3O2S and a molecular weight of 431.46 g/mol. Its IUPAC name is N-[2-[(E)-N-(N-ethyl-2-fluoroanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide.
| Compound Name | N-[2-[(E)-N-(N-ethyl-2-fluoroanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 143554330 |
| Molecular Formula | C19H21F4N3O2S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[2-[(E)-N-(N-ethyl-2-fluoroanilino)-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide |
| SMILES | CCN(/N=C(\C)c1cc(C)ccc1N(C)S(=O)(=O)C(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C19H21F4N3O2S/c1-5-26(18-9-7-6-8-16(18)20)24-14(3)15-12-13(2)10-11-17(15)25(4)29(27,28)19(21,22)23/h6-12H,5H2,1-4H3/b24-14+ |
| InChIKey | PQXGPMSAGIUXCJ-ZVHZXABRSA-N |
| XLogP | 4.67 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|