C16H13ClF4N2O3S — CID 59021263
N-[4-chloro-2-[(E)-N-(4-fluorophenoxy)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide (PubChem CID 59021263) has the molecular formula C16H13ClF4N2O3S and a molecular weight of 424.80 g/mol. Its IUPAC name is N-[4-chloro-2-[(E)-N-(4-fluorophenoxy)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide.
| Compound Name | N-[4-chloro-2-[(E)-N-(4-fluorophenoxy)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 59021263 |
| Molecular Formula | C16H13ClF4N2O3S |
| Molecular Weight | 424.80 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | N-[4-chloro-2-[(E)-N-(4-fluorophenoxy)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoro-N-methylmethanesulfonamide |
| SMILES | C/C(=N\Oc1ccc(F)cc1)c1cc(Cl)ccc1N(C)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H13ClF4N2O3S/c1-10(22-26-13-6-4-12(18)5-7-13)14-9-11(17)3-8-15(14)23(2)27(24,25)16(19,20)21/h3-9H,1-2H3/b22-10+ |
| InChIKey | OIVSSWVZTAYPGW-LSHDLFTRSA-N |
| XLogP | 4.57 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|