C17H17ClF3N3O2S — CID 87835251
N-[2-(N-anilino-C-methylcarbonimidoyl)-4-chlorophenyl]-N-ethyl-1,1,1-trifluoromethanesulfonamide (PubChem CID 87835251) has the molecular formula C17H17ClF3N3O2S and a molecular weight of 419.86 g/mol. Its IUPAC name is N-[2-(N-anilino-C-methylcarbonimidoyl)-4-chlorophenyl]-N-ethyl-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-(N-anilino-C-methylcarbonimidoyl)-4-chlorophenyl]-N-ethyl-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 87835251 |
| Molecular Formula | C17H17ClF3N3O2S |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-[2-(N-anilino-C-methylcarbonimidoyl)-4-chlorophenyl]-N-ethyl-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCN(c1ccc(Cl)cc1C(C)=NNc1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H17ClF3N3O2S/c1-3-24(27(25,26)17(19,20)21)16-10-9-13(18)11-15(16)12(2)22-23-14-7-5-4-6-8-14/h4-11,23H,3H2,1-2H3 |
| InChIKey | WPFQEZULSUCNRW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|