C23H21F3N2O4S — CID 143205609
1,1,1-trifluoro-N-[2-[(E)-N-[(4-methoxyphenyl)methoxy]-C-phenylcarbonimidoyl]-4-methylphenyl]methanesulfonamide (PubChem CID 143205609) has the molecular formula C23H21F3N2O4S and a molecular weight of 478.49 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[(E)-N-[(4-methoxyphenyl)methoxy]-C-phenylcarbonimidoyl]-4-methylphenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[(E)-N-[(4-methoxyphenyl)methoxy]-C-phenylcarbonimidoyl]-4-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 143205609 |
| Molecular Formula | C23H21F3N2O4S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[(E)-N-[(4-methoxyphenyl)methoxy]-C-phenylcarbonimidoyl]-4-methylphenyl]methanesulfonamide |
| SMILES | COc1ccc(CO/N=C(\c2ccccc2)c2cc(C)ccc2NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F3N2O4S/c1-16-8-13-21(28-33(29,30)23(24,25)26)20(14-16)22(18-6-4-3-5-7-18)27-32-15-17-9-11-19(31-2)12-10-17/h3-14,28H,15H2,1-2H3/b27-22+ |
| InChIKey | YXWYZZTZHNFZIE-HPNDGRJYSA-N |
| XLogP | 5.23 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|