C16H14F4N2O3S — CID 11675490
1,1,1-trifluoro-N-[2-[(E)-N-[(2-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]methanesulfonamide (PubChem CID 11675490) has the molecular formula C16H14F4N2O3S and a molecular weight of 390.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[(E)-N-[(2-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[(E)-N-[(2-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 11675490 |
| Molecular Formula | C16H14F4N2O3S |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[(E)-N-[(2-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]methanesulfonamide |
| SMILES | C/C(=N\OCc1ccccc1F)c1ccccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H14F4N2O3S/c1-11(21-25-10-12-6-2-4-8-14(12)17)13-7-3-5-9-15(13)22-26(23,24)16(18,19)20/h2-9,22H,10H2,1H3/b21-11+ |
| InChIKey | KCCTVKBCOSFYCK-SRZZPIQSSA-N |
| XLogP | 4.03 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|