C11H13F3N2O3S — CID 12833907
N,N-dimethyl-2-[2-(trifluoromethylsulfonylamino)phenyl]acetamide (PubChem CID 12833907) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(trifluoromethylsulfonylamino)phenyl]acetamide.
| Compound Name | N,N-dimethyl-2-[2-(trifluoromethylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 12833907 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N,N-dimethyl-2-[2-(trifluoromethylsulfonylamino)phenyl]acetamide |
| SMILES | CN(C)C(=O)Cc1ccccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O3S/c1-16(2)10(17)7-8-5-3-4-6-9(8)15-20(18,19)11(12,13)14/h3-6,15H,7H2,1-2H3 |
| InChIKey | QCQMCISPZPSKBI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |