C13H13F3N2O3S — CID 13175476
N-methyl-N-prop-2-ynyl-2-[2-(trifluoromethylsulfonylamino)phenyl]acetamide (PubChem CID 13175476) has the molecular formula C13H13F3N2O3S and a molecular weight of 334.32 g/mol. Its IUPAC name is N-methyl-N-prop-2-ynyl-2-[2-(trifluoromethylsulfonylamino)phenyl]acetamide.
| Compound Name | N-methyl-N-prop-2-ynyl-2-[2-(trifluoromethylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 13175476 |
| Molecular Formula | C13H13F3N2O3S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | N-methyl-N-prop-2-ynyl-2-[2-(trifluoromethylsulfonylamino)phenyl]acetamide |
| SMILES | C#CCN(C)C(=O)Cc1ccccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O3S/c1-3-8-18(2)12(19)9-10-6-4-5-7-11(10)17-22(20,21)13(14,15)16/h1,4-7,17H,8-9H2,2H3 |
| InChIKey | PZNHZQLAFBOSNW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|