C14H15F3N2O3S — CID 145215692
1,1,1-trifluoro-N-[2-[(3-methylidene-2-oxopiperidin-1-yl)methyl]phenyl]methanesulfonamide (PubChem CID 145215692) has the molecular formula C14H15F3N2O3S and a molecular weight of 348.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[(3-methylidene-2-oxopiperidin-1-yl)methyl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[(3-methylidene-2-oxopiperidin-1-yl)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 145215692 |
| Molecular Formula | C14H15F3N2O3S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[(3-methylidene-2-oxopiperidin-1-yl)methyl]phenyl]methanesulfonamide |
| SMILES | C=C1CCCN(Cc2ccccc2NS(=O)(=O)C(F)(F)F)C1=O |
| InChI | InChI=1S/C14H15F3N2O3S/c1-10-5-4-8-19(13(10)20)9-11-6-2-3-7-12(11)18-23(21,22)14(15,16)17/h2-3,6-7,18H,1,4-5,8-9H2 |
| InChIKey | SEJREUGFLFOZBM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|