C20H24F3N3O4S — CID 145215612
1,1,1-trifluoro-N-[2-[[(10E)-9-oxo-10-prop-2-enoxyimino-8-azaspiro[4.5]decan-8-yl]methyl]phenyl]methanesulfonamide (PubChem CID 145215612) has the molecular formula C20H24F3N3O4S and a molecular weight of 459.49 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[[(10E)-9-oxo-10-prop-2-enoxyimino-8-azaspiro[4.5]decan-8-yl]methyl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[[(10E)-9-oxo-10-prop-2-enoxyimino-8-azaspiro[4.5]decan-8-yl]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 145215612 |
| Molecular Formula | C20H24F3N3O4S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[[(10E)-9-oxo-10-prop-2-enoxyimino-8-azaspiro[4.5]decan-8-yl]methyl]phenyl]methanesulfonamide |
| SMILES | C=CCO/N=C1/C(=O)N(Cc2ccccc2NS(=O)(=O)C(F)(F)F)CCC12CCCC2 |
| InChI | InChI=1S/C20H24F3N3O4S/c1-2-13-30-24-17-18(27)26(12-11-19(17)9-5-6-10-19)14-15-7-3-4-8-16(15)25-31(28,29)20(21,22)23/h2-4,7-8,25H,1,5-6,9-14H2/b24-17- |
| InChIKey | HWUNNJCJMJVXOV-ULJHMMPZSA-N |
| XLogP | 3.80 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|