C16H19F3N2O4S — CID 145215681
N-[2-[(4-ethyl-4-methyl-2,3-dioxopiperidin-1-yl)methyl]phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 145215681) has the molecular formula C16H19F3N2O4S and a molecular weight of 392.40 g/mol. Its IUPAC name is N-[2-[(4-ethyl-4-methyl-2,3-dioxopiperidin-1-yl)methyl]phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[(4-ethyl-4-methyl-2,3-dioxopiperidin-1-yl)methyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 145215681 |
| Molecular Formula | C16H19F3N2O4S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[2-[(4-ethyl-4-methyl-2,3-dioxopiperidin-1-yl)methyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCC1(C)CCN(Cc2ccccc2NS(=O)(=O)C(F)(F)F)C(=O)C1=O |
| InChI | InChI=1S/C16H19F3N2O4S/c1-3-15(2)8-9-21(14(23)13(15)22)10-11-6-4-5-7-12(11)20-26(24,25)16(17,18)19/h4-7,20H,3,8-10H2,1-2H3 |
| InChIKey | JEGZLGIKCLBBEL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|