C21H18F3N3O3S — CID 145215688
N-[2-[[(3E)-3-[(4-cyanophenyl)methylidene]-2-oxopiperidin-1-yl]methyl]phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 145215688) has the molecular formula C21H18F3N3O3S and a molecular weight of 449.45 g/mol. Its IUPAC name is N-[2-[[(3E)-3-[(4-cyanophenyl)methylidene]-2-oxopiperidin-1-yl]methyl]phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[[(3E)-3-[(4-cyanophenyl)methylidene]-2-oxopiperidin-1-yl]methyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 145215688 |
| Molecular Formula | C21H18F3N3O3S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[2-[[(3E)-3-[(4-cyanophenyl)methylidene]-2-oxopiperidin-1-yl]methyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | N#Cc1ccc(/C=C2\CCCN(Cc3ccccc3NS(=O)(=O)C(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C21H18F3N3O3S/c22-21(23,24)31(29,30)26-19-6-2-1-4-18(19)14-27-11-3-5-17(20(27)28)12-15-7-9-16(13-25)10-8-15/h1-2,4,6-10,12,26H,3,5,11,14H2/b17-12+ |
| InChIKey | ULHIWYPQDUXUBH-SFQUDFHCSA-N |
| XLogP | 4.03 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|