C26H24ClN3O2 — CID 141437009
N-(2-aminophenyl)-4-[[(3E)-3-[(4-chlorophenyl)methylidene]-2-oxopiperidin-1-yl]methyl]benzamide (PubChem CID 141437009) has the molecular formula C26H24ClN3O2 and a molecular weight of 445.95 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(3E)-3-[(4-chlorophenyl)methylidene]-2-oxopiperidin-1-yl]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[(3E)-3-[(4-chlorophenyl)methylidene]-2-oxopiperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 141437009 |
| Molecular Formula | C26H24ClN3O2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(3E)-3-[(4-chlorophenyl)methylidene]-2-oxopiperidin-1-yl]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN2CCC/C(=C\c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H24ClN3O2/c27-22-13-9-18(10-14-22)16-21-4-3-15-30(26(21)32)17-19-7-11-20(12-8-19)25(31)29-24-6-2-1-5-23(24)28/h1-2,5-14,16H,3-4,15,17,28H2,(H,29,31)/b21-16+ |
| InChIKey | NIRHBZPDOKODLK-LTGZKZEYSA-N |
| XLogP | 5.38 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|