C17H18F3N3O2S — CID 143554468
N-[2-[(E)-N-(N-ethylanilino)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 143554468) has the molecular formula C17H18F3N3O2S and a molecular weight of 385.41 g/mol. Its IUPAC name is N-[2-[(E)-N-(N-ethylanilino)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[(E)-N-(N-ethylanilino)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 143554468 |
| Molecular Formula | C17H18F3N3O2S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[2-[(E)-N-(N-ethylanilino)-C-methylcarbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCN(/N=C(\C)c1ccccc1NS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H18F3N3O2S/c1-3-23(14-9-5-4-6-10-14)21-13(2)15-11-7-8-12-16(15)22-26(24,25)17(18,19)20/h4-12,22H,3H2,1-2H3/b21-13+ |
| InChIKey | DFOXAONPWKNNNE-FYJGNVAPSA-N |
| XLogP | 4.20 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|