C23H30F6N4O3S — CID 143554548
ethane;1-[(E)-1-[5-methyl-2-(trifluoromethylsulfonylamino)phenyl]ethylideneamino]-3-[4-(trifluoromethyl)phenyl]urea;propane (PubChem CID 143554548) has the molecular formula C23H30F6N4O3S and a molecular weight of 556.57 g/mol. Its IUPAC name is ethane;1-[(E)-1-[5-methyl-2-(trifluoromethylsulfonylamino)phenyl]ethylideneamino]-3-[4-(trifluoromethyl)phenyl]urea;propane.
| Compound Name | ethane;1-[(E)-1-[5-methyl-2-(trifluoromethylsulfonylamino)phenyl]ethylideneamino]-3-[4-(trifluoromethyl)phenyl]urea;propane |
|---|---|
| PubChem CID | 143554548 |
| Molecular Formula | C23H30F6N4O3S |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | ethane;1-[(E)-1-[5-methyl-2-(trifluoromethylsulfonylamino)phenyl]ethylideneamino]-3-[4-(trifluoromethyl)phenyl]urea;propane |
| SMILES | C/C(=N\NC(=O)Nc1ccc(C(F)(F)F)cc1)c1cc(C)ccc1NS(=O)(=O)C(F)(F)F.CC.CCC |
| InChI | InChI=1S/C18H16F6N4O3S.C3H8.C2H6/c1-10-3-8-15(28-32(30,31)18(22,23)24)14(9-10)11(2)26-27-16(29)25-13-6-4-12(5-7-13)17(19,20)21;1-3-2;1-2/h3-9,28H,1-2H3,(H2,25,27,29);3H2,1-2H3;1-2H3/b26-11+;; |
| InChIKey | YEJPLFUBSHXFIV-ZWNONVTFSA-N |
| XLogP | 7.26 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|