C15H17F2N3O2 — CID 47034526
N-[3-[2-cyanopropyl(methyl)amino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 47034526) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[3-[2-cyanopropyl(methyl)amino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[2-cyanopropyl(methyl)amino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 47034526 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[3-[2-cyanopropyl(methyl)amino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | CC(C#N)CN(C)C(=O)CCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H17F2N3O2/c1-10(8-18)9-20(2)14(21)5-6-19-15(22)12-4-3-11(16)7-13(12)17/h3-4,7,10H,5-6,9H2,1-2H3,(H,19,22) |
| InChIKey | QDKBQTJGBZCZDI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |