C17H25F2N3O2 — CID 46447028
N-[3-[2-(diethylamino)propylamino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 46447028) has the molecular formula C17H25F2N3O2 and a molecular weight of 341.40 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)propylamino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[2-(diethylamino)propylamino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 46447028 |
| Molecular Formula | C17H25F2N3O2 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[3-[2-(diethylamino)propylamino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | CCN(CC)C(C)CNC(=O)CCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H25F2N3O2/c1-4-22(5-2)12(3)11-21-16(23)8-9-20-17(24)14-7-6-13(18)10-15(14)19/h6-7,10,12H,4-5,8-9,11H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | AAWDIKGKDKXMAI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |