C16H16ClN3O5S — CID 8906032
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-chloropyridine-2-carboxylate (PubChem CID 8906032) has the molecular formula C16H16ClN3O5S and a molecular weight of 397.84 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-chloropyridine-2-carboxylate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-chloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 8906032 |
| Molecular Formula | C16H16ClN3O5S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-chloropyridine-2-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2cc(Cl)ccn2)c1 |
| InChI | InChI=1S/C16H16ClN3O5S/c1-20(2)26(23,24)13-5-3-4-12(9-13)19-15(21)10-25-16(22)14-8-11(17)6-7-18-14/h3-9H,10H2,1-2H3,(H,19,21) |
| InChIKey | XDNDLTGTRQDHPF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |