C16H16BrN3O5S — CID 3502658
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 5-bromopyridine-3-carboxylate (PubChem CID 3502658) has the molecular formula C16H16BrN3O5S and a molecular weight of 442.29 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 5-bromopyridine-3-carboxylate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 5-bromopyridine-3-carboxylate |
|---|---|
| PubChem CID | 3502658 |
| Molecular Formula | C16H16BrN3O5S |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 5-bromopyridine-3-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2cncc(Br)c2)c1 |
| InChI | InChI=1S/C16H16BrN3O5S/c1-20(2)26(23,24)14-5-3-4-13(7-14)19-15(21)10-25-16(22)11-6-12(17)9-18-8-11/h3-9H,10H2,1-2H3,(H,19,21) |
| InChIKey | WNDKSHNKBFVRNP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |