C24H23ClN2O5S2 — CID 5004260
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate (PubChem CID 5004260) has the molecular formula C24H23ClN2O5S2 and a molecular weight of 519.04 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 5004260 |
| Molecular Formula | C24H23ClN2O5S2 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2ccc(CSc3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C24H23ClN2O5S2/c1-27(2)34(30,31)22-5-3-4-20(14-22)26-23(28)15-32-24(29)18-8-6-17(7-9-18)16-33-21-12-10-19(25)11-13-21/h3-14H,15-16H2,1-2H3,(H,26,28) |
| InChIKey | IYPWWJQHWYQCCK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |