C19H21ClN2O5S2 — CID 4057883
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 4057883) has the molecular formula C19H21ClN2O5S2 and a molecular weight of 456.97 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 4057883 |
| Molecular Formula | C19H21ClN2O5S2 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COC(=O)CCSc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H21ClN2O5S2/c1-22(2)29(25,26)17-5-3-4-15(12-17)21-18(23)13-27-19(24)10-11-28-16-8-6-14(20)7-9-16/h3-9,12H,10-11,13H2,1-2H3,(H,21,23) |
| InChIKey | JKWWMRSQPUBFHL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |