C18H19ClN2O5S2 — CID 2524496
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(4-chlorophenyl)sulfanylacetate (PubChem CID 2524496) has the molecular formula C18H19ClN2O5S2 and a molecular weight of 442.95 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(4-chlorophenyl)sulfanylacetate.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(4-chlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 2524496 |
| Molecular Formula | C18H19ClN2O5S2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(4-chlorophenyl)sulfanylacetate |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)COC(=O)CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H19ClN2O5S2/c1-21(2)28(24,25)16-9-5-14(6-10-16)20-17(22)11-26-18(23)12-27-15-7-3-13(19)4-8-15/h3-10H,11-12H2,1-2H3,(H,20,22) |
| InChIKey | UTMOPYOLWIAJBB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |