C13H16N6O5S — CID 2394467
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(tetrazol-1-yl)acetate (PubChem CID 2394467) has the molecular formula C13H16N6O5S and a molecular weight of 368.38 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(tetrazol-1-yl)acetate.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(tetrazol-1-yl)acetate |
|---|---|
| PubChem CID | 2394467 |
| Molecular Formula | C13H16N6O5S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(tetrazol-1-yl)acetate |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)COC(=O)Cn2cnnn2)cc1 |
| InChI | InChI=1S/C13H16N6O5S/c1-18(2)25(22,23)11-5-3-10(4-6-11)15-12(20)8-24-13(21)7-19-9-14-16-17-19/h3-6,9H,7-8H2,1-2H3,(H,15,20) |
| InChIKey | CPKUJBVVPWNMJH-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |