C20H23NO3 — CID 7718013
[2-(4-tert-butylanilino)-2-oxoethyl] 2-methylbenzoate (PubChem CID 7718013) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 2-methylbenzoate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 7718013 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H23NO3/c1-14-7-5-6-8-17(14)19(23)24-13-18(22)21-16-11-9-15(10-12-16)20(2,3)4/h5-12H,13H2,1-4H3,(H,21,22) |
| InChIKey | CCNIIKMWDGRKAK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |