3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate

C21H26O3 — CID 75207248

IUPAC3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate
SMILESO=C(CC12CC3CC(CC(O)(C3)C1)C2)OCC=Cc1ccccc1
InChIInChI=1S/C21H26O3/c22-19(24-8-4-7-16-5-2-1-3-6-16)14-20-10-17-9-18(11-20)13-21(23,12-17)15-20/h1-7,17-18,23H,8-15H2
InChIKeyQAGLGJLSYWDIBH-UHFFFAOYSA-N
MW326.44 g/mol
LogP3.96
Rot. Bonds5

About 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate

3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate (PubChem CID 75207248) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate.

Molecular Properties

Compound Name3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate
PubChem CID75207248
Molecular FormulaC21H26O3
Molecular Weight326.44 g/mol
Exact Mass326.19
IUPAC Name3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate
SMILESO=C(CC12CC3CC(CC(O)(C3)C1)C2)OCC=Cc1ccccc1
InChIInChI=1S/C21H26O3/c22-19(24-8-4-7-16-5-2-1-3-6-16)14-20-10-17-9-18(11-20)13-21(23,12-17)15-20/h1-7,17-18,23H,8-15H2
InChIKeyQAGLGJLSYWDIBH-UHFFFAOYSA-N
XLogP3.96
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.44
LogP ≤ 53.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate?
The IUPAC name of 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate (CID 75207248) is 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate.
What is the SMILES notation for 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate?
The canonical SMILES for 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate is O=C(CC12CC3CC(CC(O)(C3)C1)C2)OCC=Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate?
The InChIKey is QAGLGJLSYWDIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O3/c22-19(24-8-4-7-16-5-2-1-3-6-16)14-20-10-17-9-18(11-20)13-21(23,12-17)15-20/h1-7,17-18,23H,8-15H2.
What are the key properties of 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate?
3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate has a molecular weight of 326.44 g/mol, XLogP of 3.96, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate is sourced from PubChem (CID 75207248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).