C21H26O3 — CID 75207248
3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate (PubChem CID 75207248) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate.
| Compound Name | 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate |
|---|---|
| PubChem CID | 75207248 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 3-phenylprop-2-enyl 2-(3-hydroxy-1-adamantyl)acetate |
| SMILES | O=C(CC12CC3CC(CC(O)(C3)C1)C2)OCC=Cc1ccccc1 |
| InChI | InChI=1S/C21H26O3/c22-19(24-8-4-7-16-5-2-1-3-6-16)14-20-10-17-9-18(11-20)13-21(23,12-17)15-20/h1-7,17-18,23H,8-15H2 |
| InChIKey | QAGLGJLSYWDIBH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |