C24H25N5O4 — CID 4879495
2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 4879495) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4879495 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)NC(Cc2c[nH]c3ccccc23)C1=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H25N5O4/c30-22(26-17-5-7-18(8-6-17)28-9-11-33-12-10-28)15-29-23(31)21(27-24(29)32)13-16-14-25-20-4-2-1-3-19(16)20/h1-8,14,21,25H,9-13,15H2,(H,26,30)(H,27,32) |
| InChIKey | FXMMGGHZAFHCIW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|