C22H27N3O4S — CID 5213116
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(1H-indol-3-yl)propanamide (PubChem CID 5213116) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 5213116 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(1H-indol-3-yl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)CCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C22H27N3O4S/c1-4-25(5-2)30(27,28)17-11-12-21(29-3)20(14-17)24-22(26)13-10-16-15-23-19-9-7-6-8-18(16)19/h6-9,11-12,14-15,23H,4-5,10,13H2,1-3H3,(H,24,26) |
| InChIKey | GVDJBWZPELEVNB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |