C13H13N3O3 — CID 40688091
3-(3,6-dioxo-1H-pyridazin-2-yl)-N-phenylpropanamide (PubChem CID 40688091) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-phenylpropanamide.
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 40688091 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-phenylpropanamide |
| SMILES | O=C(CCn1[nH]c(=O)ccc1=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H13N3O3/c17-11(14-10-4-2-1-3-5-10)8-9-16-13(19)7-6-12(18)15-16/h1-7H,8-9H2,(H,14,17)(H,15,18) |
| InChIKey | NZVQDNXOLRDOJJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |