C15H14N4O3 — CID 43824263
N-(4-cyanophenyl)-4-(3,6-dioxo-1H-pyridazin-2-yl)butanamide (PubChem CID 43824263) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-(3,6-dioxo-1H-pyridazin-2-yl)butanamide.
| Compound Name | N-(4-cyanophenyl)-4-(3,6-dioxo-1H-pyridazin-2-yl)butanamide |
|---|---|
| PubChem CID | 43824263 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(4-cyanophenyl)-4-(3,6-dioxo-1H-pyridazin-2-yl)butanamide |
| SMILES | N#Cc1ccc(NC(=O)CCCn2[nH]c(=O)ccc2=O)cc1 |
| InChI | InChI=1S/C15H14N4O3/c16-10-11-3-5-12(6-4-11)17-13(20)2-1-9-19-15(22)8-7-14(21)18-19/h3-8H,1-2,9H2,(H,17,20)(H,18,21) |
| InChIKey | UXAMYBPZLQZULD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |