C13H13ClN4O3 — CID 66423760
N-(2-aminophenyl)-3-(5-chloro-2,4-dioxopyrimidin-1-yl)propanamide (PubChem CID 66423760) has the molecular formula C13H13ClN4O3 and a molecular weight of 308.72 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-(5-chloro-2,4-dioxopyrimidin-1-yl)propanamide.
| Compound Name | N-(2-aminophenyl)-3-(5-chloro-2,4-dioxopyrimidin-1-yl)propanamide |
|---|---|
| PubChem CID | 66423760 |
| Molecular Formula | C13H13ClN4O3 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-(2-aminophenyl)-3-(5-chloro-2,4-dioxopyrimidin-1-yl)propanamide |
| SMILES | Nc1ccccc1NC(=O)CCn1cc(Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H13ClN4O3/c14-8-7-18(13(21)17-12(8)20)6-5-11(19)16-10-4-2-1-3-9(10)15/h1-4,7H,5-6,15H2,(H,16,19)(H,17,20,21) |
| InChIKey | LFNQBOOICYLZCB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|