C23H22N2O6S2 — CID 46246295
ethyl 3-[[4-(3-thiophen-2-ylsulfonylpropanoylamino)benzoyl]amino]benzoate (PubChem CID 46246295) has the molecular formula C23H22N2O6S2 and a molecular weight of 486.57 g/mol. Its IUPAC name is ethyl 3-[[4-(3-thiophen-2-ylsulfonylpropanoylamino)benzoyl]amino]benzoate.
| Compound Name | ethyl 3-[[4-(3-thiophen-2-ylsulfonylpropanoylamino)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 46246295 |
| Molecular Formula | C23H22N2O6S2 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | ethyl 3-[[4-(3-thiophen-2-ylsulfonylpropanoylamino)benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2ccc(NC(=O)CCS(=O)(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C23H22N2O6S2/c1-2-31-23(28)17-5-3-6-19(15-17)25-22(27)16-8-10-18(11-9-16)24-20(26)12-14-33(29,30)21-7-4-13-32-21/h3-11,13,15H,2,12,14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | LAVIWMFBJJUAMC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |