C21H17F3N2O5S2 — CID 46246301
4-(3-thiophen-2-ylsulfonylpropanoylamino)-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 46246301) has the molecular formula C21H17F3N2O5S2 and a molecular weight of 498.50 g/mol. Its IUPAC name is 4-(3-thiophen-2-ylsulfonylpropanoylamino)-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 4-(3-thiophen-2-ylsulfonylpropanoylamino)-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 46246301 |
| Molecular Formula | C21H17F3N2O5S2 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 4-(3-thiophen-2-ylsulfonylpropanoylamino)-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(CCS(=O)(=O)c1cccs1)Nc1ccc(C(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H17F3N2O5S2/c22-21(23,24)31-17-9-7-16(8-10-17)26-20(28)14-3-5-15(6-4-14)25-18(27)11-13-33(29,30)19-2-1-12-32-19/h1-10,12H,11,13H2,(H,25,27)(H,26,28) |
| InChIKey | QAFSRYQMEOBAAX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |