C18H19NO5S — CID 110294957
methyl 3-[3-(4-methylphenyl)sulfonylpropanoylamino]benzoate (PubChem CID 110294957) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is methyl 3-[3-(4-methylphenyl)sulfonylpropanoylamino]benzoate.
| Compound Name | methyl 3-[3-(4-methylphenyl)sulfonylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 110294957 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | methyl 3-[3-(4-methylphenyl)sulfonylpropanoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C18H19NO5S/c1-13-6-8-16(9-7-13)25(22,23)11-10-17(20)19-15-5-3-4-14(12-15)18(21)24-2/h3-9,12H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | ZIBJTDRBPJQKSS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |