C18H20N2O5S — CID 112999907
methyl 3-[[2-[(3,4-dimethylphenyl)sulfonylamino]acetyl]amino]benzoate (PubChem CID 112999907) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is methyl 3-[[2-[(3,4-dimethylphenyl)sulfonylamino]acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[(3,4-dimethylphenyl)sulfonylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 112999907 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | methyl 3-[[2-[(3,4-dimethylphenyl)sulfonylamino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CNS(=O)(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-12-7-8-16(9-13(12)2)26(23,24)19-11-17(21)20-15-6-4-5-14(10-15)18(22)25-3/h4-10,19H,11H2,1-3H3,(H,20,21) |
| InChIKey | NHSVNHUCGNEURA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |