C17H18N2O5S — CID 112999985
methyl 4-[[2-[(3-methylphenyl)sulfonylamino]acetyl]amino]benzoate (PubChem CID 112999985) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is methyl 4-[[2-[(3-methylphenyl)sulfonylamino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(3-methylphenyl)sulfonylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 112999985 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 4-[[2-[(3-methylphenyl)sulfonylamino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CNS(=O)(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C17H18N2O5S/c1-12-4-3-5-15(10-12)25(22,23)18-11-16(20)19-14-8-6-13(7-9-14)17(21)24-2/h3-10,18H,11H2,1-2H3,(H,19,20) |
| InChIKey | AIXYWOKBXAIIKK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |