C18H20N4O3 — CID 26076497
4-(carbamoylamino)-N-[2-(2-ethylanilino)-2-oxoethyl]benzamide (PubChem CID 26076497) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-(carbamoylamino)-N-[2-(2-ethylanilino)-2-oxoethyl]benzamide.
| Compound Name | 4-(carbamoylamino)-N-[2-(2-ethylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 26076497 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-(carbamoylamino)-N-[2-(2-ethylanilino)-2-oxoethyl]benzamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C18H20N4O3/c1-2-12-5-3-4-6-15(12)22-16(23)11-20-17(24)13-7-9-14(10-8-13)21-18(19)25/h3-10H,2,11H2,1H3,(H,20,24)(H,22,23)(H3,19,21,25) |
| InChIKey | UHHQLOOWIKTSQL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |