C18H26N2O3 — CID 109031506
methyl 4-[[3-(cycloheptylamino)-3-oxopropyl]amino]benzoate (PubChem CID 109031506) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is methyl 4-[[3-(cycloheptylamino)-3-oxopropyl]amino]benzoate.
| Compound Name | methyl 4-[[3-(cycloheptylamino)-3-oxopropyl]amino]benzoate |
|---|---|
| PubChem CID | 109031506 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | methyl 4-[[3-(cycloheptylamino)-3-oxopropyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NCCC(=O)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-23-18(22)14-8-10-15(11-9-14)19-13-12-17(21)20-16-6-4-2-3-5-7-16/h8-11,16,19H,2-7,12-13H2,1H3,(H,20,21) |
| InChIKey | RRSWLNKJDLVSGM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |