C19H17F2NO6 — CID 7902950
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3-acetylphenoxy)acetate (PubChem CID 7902950) has the molecular formula C19H17F2NO6 and a molecular weight of 393.34 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3-acetylphenoxy)acetate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3-acetylphenoxy)acetate |
|---|---|
| PubChem CID | 7902950 |
| Molecular Formula | C19H17F2NO6 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3-acetylphenoxy)acetate |
| SMILES | CC(=O)c1cccc(OCC(=O)OCC(=O)Nc2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C19H17F2NO6/c1-12(23)13-5-4-6-14(9-13)26-11-18(25)27-10-17(24)22-15-7-2-3-8-16(15)28-19(20)21/h2-9,19H,10-11H2,1H3,(H,22,24) |
| InChIKey | MTYDEVRYMUDGQI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |