C18H15N3O6 — CID 7507105
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate (PubChem CID 7507105) has the molecular formula C18H15N3O6 and a molecular weight of 369.33 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 7507105 |
| Molecular Formula | C18H15N3O6 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)c2ccccc2[nH]1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H15N3O6/c22-15-8-14(20-13-6-2-1-5-12(13)15)17(24)27-10-16(23)21-18(25)19-9-11-4-3-7-26-11/h1-8H,9-10H2,(H,20,22)(H2,19,21,23,25) |
| InChIKey | OOQUSSUNEXZIBI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |