C15H16N2O5 — CID 7507078
[2-(2-methoxyethylamino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate (PubChem CID 7507078) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 7507078 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate |
| SMILES | COCCNC(=O)COC(=O)c1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C15H16N2O5/c1-21-7-6-16-14(19)9-22-15(20)12-8-13(18)10-4-2-3-5-11(10)17-12/h2-5,8H,6-7,9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | BUTUJTUKPNEBFD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|