C18H16N2O8S — CID 2669560
[2-oxo-2-(prop-2-enylamino)ethyl] 4-(3-nitrophenyl)sulfonyloxybenzoate (PubChem CID 2669560) has the molecular formula C18H16N2O8S and a molecular weight of 420.40 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 4-(3-nitrophenyl)sulfonyloxybenzoate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-(3-nitrophenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 2669560 |
| Molecular Formula | C18H16N2O8S |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 4-(3-nitrophenyl)sulfonyloxybenzoate |
| SMILES | C=CCNC(=O)COC(=O)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H16N2O8S/c1-2-10-19-17(21)12-27-18(22)13-6-8-15(9-7-13)28-29(25,26)16-5-3-4-14(11-16)20(23)24/h2-9,11H,1,10,12H2,(H,19,21) |
| InChIKey | KRJDDTVUHHPYDA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|