C22H17N3O5 — CID 135670461
N-[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]-2-nitrobenzamide (PubChem CID 135670461) has the molecular formula C22H17N3O5 and a molecular weight of 403.39 g/mol. Its IUPAC name is N-[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]-2-nitrobenzamide.
| Compound Name | N-[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 135670461 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]-2-nitrobenzamide |
| SMILES | Cc1cc2nc(-c3ccc(NC(=O)c4ccccc4[N+](=O)[O-])cc3O)oc2cc1C |
| InChI | InChI=1S/C22H17N3O5/c1-12-9-17-20(10-13(12)2)30-22(24-17)16-8-7-14(11-19(16)26)23-21(27)15-5-3-4-6-18(15)25(28)29/h3-11,26H,1-2H3,(H,23,27) |
| InChIKey | QZIYEDMQOOZCQD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|