C21H17N3O3 — CID 135681250
N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]pyridine-2-carboxamide (PubChem CID 135681250) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]pyridine-2-carboxamide.
| Compound Name | N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135681250 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]pyridine-2-carboxamide |
| SMILES | Cc1cc2nc(-c3cc(NC(=O)c4ccccn4)ccc3O)oc2cc1C |
| InChI | InChI=1S/C21H17N3O3/c1-12-9-17-19(10-13(12)2)27-21(24-17)15-11-14(6-7-18(15)25)23-20(26)16-5-3-4-8-22-16/h3-11,25H,1-2H3,(H,23,26) |
| InChIKey | HIAPDSHNVLWQNO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|